C15H18FN — CID 143638589
5-fluoro-N,2-dimethylaniline;toluene (PubChem CID 143638589) has the molecular formula C15H18FN and a molecular weight of 231.31 g/mol. Its IUPAC name is 5-fluoro-N,2-dimethylaniline;toluene.
| Compound Name | 5-fluoro-N,2-dimethylaniline;toluene |
|---|---|
| PubChem CID | 143638589 |
| Molecular Formula | C15H18FN |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 5-fluoro-N,2-dimethylaniline;toluene |
| SMILES | CNc1cc(F)ccc1C.Cc1ccccc1 |
| InChI | InChI=1S/C8H10FN.C7H8/c1-6-3-4-7(9)5-8(6)10-2;1-7-5-3-2-4-6-7/h3-5,10H,1-2H3;2-6H,1H3 |
| InChIKey | NMYUNDGKVJFNCC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |