C15H17NO — CID 143638842
(2E,4E)-5-(2-pyrrolidin-1-ylphenyl)penta-2,4-dienal (PubChem CID 143638842) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is (2E,4E)-5-(2-pyrrolidin-1-ylphenyl)penta-2,4-dienal.
| Compound Name | (2E,4E)-5-(2-pyrrolidin-1-ylphenyl)penta-2,4-dienal |
|---|---|
| PubChem CID | 143638842 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (2E,4E)-5-(2-pyrrolidin-1-ylphenyl)penta-2,4-dienal |
| SMILES | O=C/C=C/C=C/c1ccccc1N1CCCC1 |
| InChI | InChI=1S/C15H17NO/c17-13-7-1-2-8-14-9-3-4-10-15(14)16-11-5-6-12-16/h1-4,7-10,13H,5-6,11-12H2/b7-1+,8-2+ |
| InChIKey | MLJQETHQAXEFSW-FACPPWRESA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|