C28H33ClN2O5S — CID 143638922
(3S)-2-[[4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]phenyl]-2-methylbenzoyl]amino]-3-hydroxybutanoic acid;methoxymethane (PubChem CID 143638922) has the molecular formula C28H33ClN2O5S and a molecular weight of 545.10 g/mol. Its IUPAC name is (3S)-2-[[4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]phenyl]-2-methylbenzoyl]amino]-3-hydroxybutanoic acid;methoxymethane.
| Compound Name | (3S)-2-[[4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]phenyl]-2-methylbenzoyl]amino]-3-hydroxybutanoic acid;methoxymethane |
|---|---|
| PubChem CID | 143638922 |
| Molecular Formula | C28H33ClN2O5S |
| Molecular Weight | 545.10 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | (3S)-2-[[4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]phenyl]-2-methylbenzoyl]amino]-3-hydroxybutanoic acid;methoxymethane |
| SMILES | COC.Cc1cc(SNc2cccc(-c3ccc(C(=O)NC(C(=O)O)[C@H](C)O)c(C)c3)c2)c(C)cc1Cl |
| InChI | InChI=1S/C26H27ClN2O4S.C2H6O/c1-14-10-19(8-9-21(14)25(31)28-24(17(4)30)26(32)33)18-6-5-7-20(13-18)29-34-23-12-15(2)22(27)11-16(23)3;1-3-2/h5-13,17,24,29-30H,1-4H3,(H,28,31)(H,32,33);1-2H3/t17-,24?;/m0./s1 |
| InChIKey | WXKTXAFIHHKJNY-VIUMTJHJSA-N |
| XLogP | 5.88 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.10 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|