C23H22ClNO2S — CID 89289577
methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate (PubChem CID 89289577) has the molecular formula C23H22ClNO2S and a molecular weight of 411.95 g/mol. Its IUPAC name is methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate.
| Compound Name | methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate |
|---|---|
| PubChem CID | 89289577 |
| Molecular Formula | C23H22ClNO2S |
| Molecular Weight | 411.95 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cccc(NSc3cc(C)c(Cl)cc3C)c2C)cc1 |
| InChI | InChI=1S/C23H22ClNO2S/c1-14-13-22(15(2)12-20(14)24)28-25-21-7-5-6-19(16(21)3)17-8-10-18(11-9-17)23(26)27-4/h5-13,25H,1-4H3 |
| InChIKey | SSDKLYVJKDZPCF-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.95 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|