About methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate
methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate (PubChem CID 89289577) has the molecular formula C23H22ClNO2S
and a molecular weight of 411.95 g/mol. Its IUPAC name is methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate |
| PubChem CID | 89289577 |
| Molecular Formula | C23H22ClNO2S |
| Molecular Weight | 411.95 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cccc(NSc3cc(C)c(Cl)cc3C)c2C)cc1 |
| InChI | InChI=1S/C23H22ClNO2S/c1-14-13-22(15(2)12-20(14)24)28-25-21-7-5-6-19(16(21)3)17-8-10-18(11-9-17)23(26)27-4/h5-13,25H,1-4H3 |
| InChIKey | SSDKLYVJKDZPCF-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.95 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate?
The IUPAC name of methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate (CID 89289577) is methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate.
What is the SMILES notation for methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate?
The canonical SMILES for methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate is COC(=O)c1ccc(-c2cccc(NSc3cc(C)c(Cl)cc3C)c2C)cc1.
What is the InChIKey of methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate?
The InChIKey is SSDKLYVJKDZPCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22ClNO2S/c1-14-13-22(15(2)12-20(14)24)28-25-21-7-5-6-19(16(21)3)17-8-10-18(11-9-17)23(26)27-4/h5-13,25H,1-4H3.
What are the key properties of methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate?
methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate has a molecular weight of 411.95 g/mol, XLogP of 6.84, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfanylamino]-2-methylphenyl]benzoate is sourced from PubChem (CID 89289577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).