C8H7F2N3O — CID 143638955
(3,3-difluoroazetidin-1-yl)-pyrimidin-2-ylmethanone (PubChem CID 143638955) has the molecular formula C8H7F2N3O and a molecular weight of 199.16 g/mol. Its IUPAC name is (3,3-difluoroazetidin-1-yl)-pyrimidin-2-ylmethanone.
| Compound Name | (3,3-difluoroazetidin-1-yl)-pyrimidin-2-ylmethanone |
|---|---|
| PubChem CID | 143638955 |
| Molecular Formula | C8H7F2N3O |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | (3,3-difluoroazetidin-1-yl)-pyrimidin-2-ylmethanone |
| SMILES | O=C(c1ncccn1)N1CC(F)(F)C1 |
| InChI | InChI=1S/C8H7F2N3O/c9-8(10)4-13(5-8)7(14)6-11-2-1-3-12-6/h1-3H,4-5H2 |
| InChIKey | NBUUZHKLVOUJPM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |