C16H21O3P — CID 143639201
ethane;4-[2-(4-hydroxyphenyl)ethyl]-2-phosphanylbenzene-1,3-diol (PubChem CID 143639201) has the molecular formula C16H21O3P and a molecular weight of 292.32 g/mol. Its IUPAC name is ethane;4-[2-(4-hydroxyphenyl)ethyl]-2-phosphanylbenzene-1,3-diol.
| Compound Name | ethane;4-[2-(4-hydroxyphenyl)ethyl]-2-phosphanylbenzene-1,3-diol |
|---|---|
| PubChem CID | 143639201 |
| Molecular Formula | C16H21O3P |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | ethane;4-[2-(4-hydroxyphenyl)ethyl]-2-phosphanylbenzene-1,3-diol |
| SMILES | CC.Oc1ccc(CCc2ccc(O)c(P)c2O)cc1 |
| InChI | InChI=1S/C14H15O3P.C2H6/c15-11-6-2-9(3-7-11)1-4-10-5-8-12(16)14(18)13(10)17;1-2/h2-3,5-8,15-17H,1,4,18H2;1-2H3 |
| InChIKey | SKDKTHXIUKCKPW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|