C11H24O2 — CID 143641671
(3R)-3,5-dimethylhexan-2-ol;propan-2-one (PubChem CID 143641671) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is (3R)-3,5-dimethylhexan-2-ol;propan-2-one.
| Compound Name | (3R)-3,5-dimethylhexan-2-ol;propan-2-one |
|---|---|
| PubChem CID | 143641671 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | (3R)-3,5-dimethylhexan-2-ol;propan-2-one |
| SMILES | CC(C)=O.CC(C)C[C@@H](C)C(C)O |
| InChI | InChI=1S/C8H18O.C3H6O/c1-6(2)5-7(3)8(4)9;1-3(2)4/h6-9H,5H2,1-4H3;1-2H3/t7-,8?;/m1./s1 |
| InChIKey | DEFQVBNVYQARQO-PGMKYVDRSA-N |
| XLogP | 2.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |