About 3-ethylfuran;3-ethyl-2-methylfuran
3-ethylfuran;3-ethyl-2-methylfuran (PubChem CID 143642378) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 3-ethylfuran;3-ethyl-2-methylfuran.
Molecular Properties
| Compound Name | 3-ethylfuran;3-ethyl-2-methylfuran |
| PubChem CID | 143642378 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 3-ethylfuran;3-ethyl-2-methylfuran |
| SMILES | CCc1ccoc1.CCc1ccoc1C |
| InChI | InChI=1S/C7H10O.C6H8O/c1-3-7-4-5-8-6(7)2;1-2-6-3-4-7-5-6/h4-5H,3H2,1-2H3;3-5H,2H2,1H3 |
| InChIKey | ZRYUGYBGHFEDCY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethylfuran;3-ethyl-2-methylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylfuran;3-ethyl-2-methylfuran?
The IUPAC name of 3-ethylfuran;3-ethyl-2-methylfuran (CID 143642378) is 3-ethylfuran;3-ethyl-2-methylfuran.
What is the SMILES notation for 3-ethylfuran;3-ethyl-2-methylfuran?
The canonical SMILES for 3-ethylfuran;3-ethyl-2-methylfuran is CCc1ccoc1.CCc1ccoc1C.
What is the InChIKey of 3-ethylfuran;3-ethyl-2-methylfuran?
The InChIKey is ZRYUGYBGHFEDCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O.C6H8O/c1-3-7-4-5-8-6(7)2;1-2-6-3-4-7-5-6/h4-5H,3H2,1-2H3;3-5H,2H2,1H3.
What are the key properties of 3-ethylfuran;3-ethyl-2-methylfuran?
3-ethylfuran;3-ethyl-2-methylfuran has a molecular weight of 206.28 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylfuran;3-ethyl-2-methylfuran is sourced from PubChem (CID 143642378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).