C19H30N2O2S — CID 143643565
(1S,5Z,13Z,15S)-5-[(Z)-but-1-enyl]-6-methyl-2-methylidene-4λ6-thia-3,7-diazabicyclo[13.1.0]hexadeca-5,13-diene 4,4-dioxide (PubChem CID 143643565) has the molecular formula C19H30N2O2S and a molecular weight of 350.53 g/mol. Its IUPAC name is (1S,5Z,13Z,15S)-5-[(Z)-but-1-enyl]-6-methyl-2-methylidene-4λ6-thia-3,7-diazabicyclo[13.1.0]hexadeca-5,13-diene 4,4-dioxide.
| Compound Name | (1S,5Z,13Z,15S)-5-[(Z)-but-1-enyl]-6-methyl-2-methylidene-4λ6-thia-3,7-diazabicyclo[13.1.0]hexadeca-5,13-diene 4,4-dioxide |
|---|---|
| PubChem CID | 143643565 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (1S,5Z,13Z,15S)-5-[(Z)-but-1-enyl]-6-methyl-2-methylidene-4λ6-thia-3,7-diazabicyclo[13.1.0]hexadeca-5,13-diene 4,4-dioxide |
| SMILES | C=C1NS(=O)(=O)C(/C=C\CC)=C(/C)NCCCCC/C=C\[C@@H]2C[C@H]12 |
| InChI | InChI=1S/C19H30N2O2S/c1-4-5-12-19-16(3)20-13-10-8-6-7-9-11-17-14-18(17)15(2)21-24(19,22)23/h5,9,11-12,17-18,20-21H,2,4,6-8,10,13-14H2,1,3H3/b11-9-,12-5-,19-16-/t17-,18-/m1/s1 |
| InChIKey | BSQBZGGUIDAXMU-GOBKMPHUSA-N |
| XLogP | 3.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|