C12H24N2O2S — CID 163637469
(E,2S,4S)-2-ethenyl-5-(ethylamino)-4-methylhept-5-ene-1-sulfonamide (PubChem CID 163637469) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is (E,2S,4S)-2-ethenyl-5-(ethylamino)-4-methylhept-5-ene-1-sulfonamide.
| Compound Name | (E,2S,4S)-2-ethenyl-5-(ethylamino)-4-methylhept-5-ene-1-sulfonamide |
|---|---|
| PubChem CID | 163637469 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (E,2S,4S)-2-ethenyl-5-(ethylamino)-4-methylhept-5-ene-1-sulfonamide |
| SMILES | C=C[C@H](C[C@H](C)/C(=C\C)NCC)CS(N)(=O)=O |
| InChI | InChI=1S/C12H24N2O2S/c1-5-11(9-17(13,15)16)8-10(4)12(6-2)14-7-3/h5-6,10-11,14H,1,7-9H2,2-4H3,(H2,13,15,16)/b12-6+/t10-,11+/m0/s1 |
| InChIKey | IBKUZFCFFSDNGY-GNAUDSRASA-N |
| XLogP | 1.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|