C11H22N2O2S — CID 97326164
2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-N-ethylethanesulfonamide (PubChem CID 97326164) has the molecular formula C11H22N2O2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-N-ethylethanesulfonamide.
| Compound Name | 2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 97326164 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-N-ethylethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNC[C@H]1CC=CCC1 |
| InChI | InChI=1S/C11H22N2O2S/c1-2-13-16(14,15)9-8-12-10-11-6-4-3-5-7-11/h3-4,11-13H,2,5-10H2,1H3/t11-/m0/s1 |
| InChIKey | XBFHPLPDKJXCDY-NSHDSACASA-N |
| XLogP | 0.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|