C30H34N2O5 — CID 143643962
[3-(4-hydroxyphenyl)-2-(4-methylphenyl)-2,7-diazaspiro[3.5]nonan-7-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 143643962) has the molecular formula C30H34N2O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is [3-(4-hydroxyphenyl)-2-(4-methylphenyl)-2,7-diazaspiro[3.5]nonan-7-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [3-(4-hydroxyphenyl)-2-(4-methylphenyl)-2,7-diazaspiro[3.5]nonan-7-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 143643962 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | [3-(4-hydroxyphenyl)-2-(4-methylphenyl)-2,7-diazaspiro[3.5]nonan-7-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCC3(CC2)CN(c2ccc(C)cc2)C3c2ccc(O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C30H34N2O5/c1-20-5-9-23(10-6-20)32-19-30(28(32)21-7-11-24(33)12-8-21)13-15-31(16-14-30)29(34)22-17-25(35-2)27(37-4)26(18-22)36-3/h5-12,17-18,28,33H,13-16,19H2,1-4H3 |
| InChIKey | LKJMZGQOHOXQKY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|