C39H50N4O3 — CID 143646259
4-tert-butyl-N-[2-methyl-3-[4-methyl-5-oxo-6-[4-(2-propylheptoxy)anilino]pyrazin-2-yl]phenyl]benzamide (PubChem CID 143646259) has the molecular formula C39H50N4O3 and a molecular weight of 622.85 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-methyl-3-[4-methyl-5-oxo-6-[4-(2-propylheptoxy)anilino]pyrazin-2-yl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-methyl-3-[4-methyl-5-oxo-6-[4-(2-propylheptoxy)anilino]pyrazin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 143646259 |
| Molecular Formula | C39H50N4O3 |
| Molecular Weight | 622.85 g/mol |
| Exact Mass | 622.39 |
| IUPAC Name | 4-tert-butyl-N-[2-methyl-3-[4-methyl-5-oxo-6-[4-(2-propylheptoxy)anilino]pyrazin-2-yl]phenyl]benzamide |
| SMILES | CCCCCC(CCC)COc1ccc(Nc2nc(-c3cccc(NC(=O)c4ccc(C(C)(C)C)cc4)c3C)cn(C)c2=O)cc1 |
| InChI | InChI=1S/C39H50N4O3/c1-8-10-11-14-28(13-9-2)26-46-32-23-21-31(22-24-32)40-36-38(45)43(7)25-35(41-36)33-15-12-16-34(27(33)3)42-37(44)29-17-19-30(20-18-29)39(4,5)6/h12,15-25,28H,8-11,13-14,26H2,1-7H3,(H,40,41)(H,42,44) |
| InChIKey | JTMNKLSOBFAJHO-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.85 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|