C24H21N3O3S2 — CID 143646995
1-(benzenesulfonyl)-4-(4-pyrrolidin-1-ylsulfanylphenyl)pyrrolo[2,3-b]pyridine-2-carbaldehyde (PubChem CID 143646995) has the molecular formula C24H21N3O3S2 and a molecular weight of 463.58 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-(4-pyrrolidin-1-ylsulfanylphenyl)pyrrolo[2,3-b]pyridine-2-carbaldehyde.
| Compound Name | 1-(benzenesulfonyl)-4-(4-pyrrolidin-1-ylsulfanylphenyl)pyrrolo[2,3-b]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 143646995 |
| Molecular Formula | C24H21N3O3S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 1-(benzenesulfonyl)-4-(4-pyrrolidin-1-ylsulfanylphenyl)pyrrolo[2,3-b]pyridine-2-carbaldehyde |
| SMILES | O=Cc1cc2c(-c3ccc(SN4CCCC4)cc3)ccnc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21N3O3S2/c28-17-19-16-23-22(18-8-10-20(11-9-18)31-26-14-4-5-15-26)12-13-25-24(23)27(19)32(29,30)21-6-2-1-3-7-21/h1-3,6-13,16-17H,4-5,14-15H2 |
| InChIKey | IHYFGLIJHVBGPO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|