C26H32F3N3O3S2 — CID 143647097
4-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-4-yl)-N-(1-oxothian-4-yl)benzenesulfonamide;3,3,3-trifluoro-2-methylprop-1-ene (PubChem CID 143647097) has the molecular formula C26H32F3N3O3S2 and a molecular weight of 555.69 g/mol. Its IUPAC name is 4-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-4-yl)-N-(1-oxothian-4-yl)benzenesulfonamide;3,3,3-trifluoro-2-methylprop-1-ene.
| Compound Name | 4-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-4-yl)-N-(1-oxothian-4-yl)benzenesulfonamide;3,3,3-trifluoro-2-methylprop-1-ene |
|---|---|
| PubChem CID | 143647097 |
| Molecular Formula | C26H32F3N3O3S2 |
| Molecular Weight | 555.69 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 4-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-4-yl)-N-(1-oxothian-4-yl)benzenesulfonamide;3,3,3-trifluoro-2-methylprop-1-ene |
| SMILES | C=C(C)C(F)(F)F.CC(C)(C)c1cc2c(-c3ccc(S(=O)(=O)NC4CCS(=O)CC4)cc3)ccnc2[nH]1 |
| InChI | InChI=1S/C22H27N3O3S2.C4H5F3/c1-22(2,3)20-14-19-18(8-11-23-21(19)24-20)15-4-6-17(7-5-15)30(27,28)25-16-9-12-29(26)13-10-16;1-3(2)4(5,6)7/h4-8,11,14,16,25H,9-10,12-13H2,1-3H3,(H,23,24);1H2,2H3 |
| InChIKey | PZPPJUJXJKMPGK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|