C18H21BrO2 — CID 143647606
methyl 2-[(4Z,6E)-6-bromo-4-ethenylocta-4,6-dienyl]benzoate (PubChem CID 143647606) has the molecular formula C18H21BrO2 and a molecular weight of 349.27 g/mol. Its IUPAC name is methyl 2-[(4Z,6E)-6-bromo-4-ethenylocta-4,6-dienyl]benzoate.
| Compound Name | methyl 2-[(4Z,6E)-6-bromo-4-ethenylocta-4,6-dienyl]benzoate |
|---|---|
| PubChem CID | 143647606 |
| Molecular Formula | C18H21BrO2 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | methyl 2-[(4Z,6E)-6-bromo-4-ethenylocta-4,6-dienyl]benzoate |
| SMILES | C=C/C(=C\C(Br)=C/C)CCCc1ccccc1C(=O)OC |
| InChI | InChI=1S/C18H21BrO2/c1-4-14(13-16(19)5-2)9-8-11-15-10-6-7-12-17(15)18(20)21-3/h4-7,10,12-13H,1,8-9,11H2,2-3H3/b14-13+,16-5+ |
| InChIKey | WDJHKHDMKNXEAQ-NSIMVMACSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|