C22H28N5PS — CID 143648915
(5Z,8E)-2-N-(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)-4-methyl-8-phosphanyldeca-5,8-diene-1,2-diamine (PubChem CID 143648915) has the molecular formula C22H28N5PS and a molecular weight of 425.54 g/mol. Its IUPAC name is (5Z,8E)-2-N-(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)-4-methyl-8-phosphanyldeca-5,8-diene-1,2-diamine.
| Compound Name | (5Z,8E)-2-N-(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)-4-methyl-8-phosphanyldeca-5,8-diene-1,2-diamine |
|---|---|
| PubChem CID | 143648915 |
| Molecular Formula | C22H28N5PS |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (5Z,8E)-2-N-(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)-4-methyl-8-phosphanyldeca-5,8-diene-1,2-diamine |
| SMILES | C/C=C(/P)C/C=C\C(C)CC(CN)Nc1nnc(-c2ccc3cnccc3c2)s1 |
| InChI | InChI=1S/C22H28N5PS/c1-3-20(28)6-4-5-15(2)11-19(13-23)25-22-27-26-21(29-22)17-7-8-18-14-24-10-9-16(18)12-17/h3-5,7-10,12,14-15,19H,6,11,13,23,28H2,1-2H3,(H,25,27)/b5-4-,20-3+ |
| InChIKey | GSSWNZFCUVGPRA-VWVIUBMMSA-N |
| XLogP | 5.24 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|