C22H27N3O5 — CID 143649882
2-[[(E)-but-2-enyl]-[2-(3-methoxyphenyl)-4-methyl-1,3-oxazole-5-carbonyl]amino]acetic acid;N-methylprop-2-en-1-imine (PubChem CID 143649882) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 2-[[(E)-but-2-enyl]-[2-(3-methoxyphenyl)-4-methyl-1,3-oxazole-5-carbonyl]amino]acetic acid;N-methylprop-2-en-1-imine.
| Compound Name | 2-[[(E)-but-2-enyl]-[2-(3-methoxyphenyl)-4-methyl-1,3-oxazole-5-carbonyl]amino]acetic acid;N-methylprop-2-en-1-imine |
|---|---|
| PubChem CID | 143649882 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-[[(E)-but-2-enyl]-[2-(3-methoxyphenyl)-4-methyl-1,3-oxazole-5-carbonyl]amino]acetic acid;N-methylprop-2-en-1-imine |
| SMILES | C/C=C/CN(CC(=O)O)C(=O)c1oc(-c2cccc(OC)c2)nc1C.C=C/C=N/C |
| InChI | InChI=1S/C18H20N2O5.C4H7N/c1-4-5-9-20(11-15(21)22)18(23)16-12(2)19-17(25-16)13-7-6-8-14(10-13)24-3;1-3-4-5-2/h4-8,10H,9,11H2,1-3H3,(H,21,22);3-4H,1H2,2H3/b2*5-4+ |
| InChIKey | HKOMKMIMGJKALK-FLYFVYFHSA-N |
| XLogP | 3.63 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|