About benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene
benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene (PubChem CID 143650226) has the molecular formula C28H30
and a molecular weight of 366.55 g/mol. Its IUPAC name is benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene.
Molecular Properties
| Compound Name | benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene |
| PubChem CID | 143650226 |
| Molecular Formula | C28H30 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene |
| SMILES | C.Cc1ccc(-c2ccccc2C(C)c2ccccc2)cc1.c1ccccc1 |
| InChI | InChI=1S/C21H20.C6H6.CH4/c1-16-12-14-19(15-13-16)21-11-7-6-10-20(21)17(2)18-8-4-3-5-9-18;1-2-4-6-5-3-1;/h3-15,17H,1-2H3;1-6H;1H4 |
| InChIKey | MXLGXVRWHBQAPX-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene?
The IUPAC name of benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene (CID 143650226) is benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene.
What is the SMILES notation for benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene?
The canonical SMILES for benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene is C.Cc1ccc(-c2ccccc2C(C)c2ccccc2)cc1.c1ccccc1.
What is the InChIKey of benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene?
The InChIKey is MXLGXVRWHBQAPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20.C6H6.CH4/c1-16-12-14-19(15-13-16)21-11-7-6-10-20(21)17(2)18-8-4-3-5-9-18;1-2-4-6-5-3-1;/h3-15,17H,1-2H3;1-6H;1H4.
What are the key properties of benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene?
benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene has a molecular weight of 366.55 g/mol, XLogP of 8.14, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;methane;1-methyl-4-[2-(1-phenylethyl)phenyl]benzene is sourced from PubChem (CID 143650226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).