C26H24N4O3S — CID 143650546
4-[(2-methylquinolin-4-yl)methoxy]-N-[6-(2-oxo-3H-1,3,4-thiadiazol-5-yl)cyclohex-3-en-1-yl]benzamide (PubChem CID 143650546) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is 4-[(2-methylquinolin-4-yl)methoxy]-N-[6-(2-oxo-3H-1,3,4-thiadiazol-5-yl)cyclohex-3-en-1-yl]benzamide.
| Compound Name | 4-[(2-methylquinolin-4-yl)methoxy]-N-[6-(2-oxo-3H-1,3,4-thiadiazol-5-yl)cyclohex-3-en-1-yl]benzamide |
|---|---|
| PubChem CID | 143650546 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 4-[(2-methylquinolin-4-yl)methoxy]-N-[6-(2-oxo-3H-1,3,4-thiadiazol-5-yl)cyclohex-3-en-1-yl]benzamide |
| SMILES | Cc1cc(COc2ccc(C(=O)NC3CC=CCC3c3n[nH]c(=O)s3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C26H24N4O3S/c1-16-14-18(20-6-2-4-8-22(20)27-16)15-33-19-12-10-17(11-13-19)24(31)28-23-9-5-3-7-21(23)25-29-30-26(32)34-25/h2-6,8,10-14,21,23H,7,9,15H2,1H3,(H,28,31)(H,30,32) |
| InChIKey | LAJLWZRGTAQQQY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|