C25H25N5O3S — CID 87903103
4-[(2-methylquinolin-4-yl)methoxy]-N-[(3R,4R)-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)oxan-4-yl]benzamide (PubChem CID 87903103) has the molecular formula C25H25N5O3S and a molecular weight of 475.57 g/mol. Its IUPAC name is 4-[(2-methylquinolin-4-yl)methoxy]-N-[(3R,4R)-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)oxan-4-yl]benzamide.
| Compound Name | 4-[(2-methylquinolin-4-yl)methoxy]-N-[(3R,4R)-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 87903103 |
| Molecular Formula | C25H25N5O3S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 4-[(2-methylquinolin-4-yl)methoxy]-N-[(3R,4R)-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)oxan-4-yl]benzamide |
| SMILES | Cc1cc(COc2ccc(C(=O)N[C@@H]3CCOC[C@H]3c3nc(=S)[nH][nH]3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C25H25N5O3S/c1-15-12-17(19-4-2-3-5-21(19)26-15)13-33-18-8-6-16(7-9-18)24(31)27-22-10-11-32-14-20(22)23-28-25(34)30-29-23/h2-9,12,20,22H,10-11,13-14H2,1H3,(H,27,31)(H2,28,29,30,34)/t20-,22-/m1/s1 |
| InChIKey | XZCDAPHMYWQDPY-IFMALSPDSA-N |
| XLogP | 4.21 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|