C26H28N2O5 — CID 66912603
methyl 2-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-2-(oxan-4-yl)acetate (PubChem CID 66912603) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is methyl 2-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-2-(oxan-4-yl)acetate.
| Compound Name | methyl 2-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-2-(oxan-4-yl)acetate |
|---|---|
| PubChem CID | 66912603 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | methyl 2-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-2-(oxan-4-yl)acetate |
| SMILES | COC(=O)C(NC(=O)c1ccc(OCc2cc(C)nc3ccccc23)cc1)C1CCOCC1 |
| InChI | InChI=1S/C26H28N2O5/c1-17-15-20(22-5-3-4-6-23(22)27-17)16-33-21-9-7-19(8-10-21)25(29)28-24(26(30)31-2)18-11-13-32-14-12-18/h3-10,15,18,24H,11-14,16H2,1-2H3,(H,28,29) |
| InChIKey | VFGQCQIBSLOKAU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |