C27H27F3N6O4S — CID 87903131
4-[(2-methylquinolin-4-yl)methoxy]-N-[(3S,4R)-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)piperidin-4-yl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 87903131) has the molecular formula C27H27F3N6O4S and a molecular weight of 588.61 g/mol. Its IUPAC name is 4-[(2-methylquinolin-4-yl)methoxy]-N-[(3S,4R)-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)piperidin-4-yl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[(2-methylquinolin-4-yl)methoxy]-N-[(3S,4R)-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)piperidin-4-yl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87903131 |
| Molecular Formula | C27H27F3N6O4S |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | 4-[(2-methylquinolin-4-yl)methoxy]-N-[(3S,4R)-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)piperidin-4-yl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(COc2ccc(C(=O)N[C@@H]3CCNC[C@@H]3c3nc(=S)[nH][nH]3)cc2)c2ccccc2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H26N6O2S.C2HF3O2/c1-15-12-17(19-4-2-3-5-21(19)27-15)14-33-18-8-6-16(7-9-18)24(32)28-22-10-11-26-13-20(22)23-29-25(34)31-30-23;3-2(4,5)1(6)7/h2-9,12,20,22,26H,10-11,13-14H2,1H3,(H,28,32)(H2,29,30,31,34);(H,6,7)/t20-,22+;/m0./s1 |
| InChIKey | CRFFMRVOXYYNBN-IKGOIYPNSA-N |
| XLogP | 4.41 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|