C21H22N2O4S — CID 143650945
4-[[2-(3,5-dimethoxyphenyl)-4-ethyl-1,3-thiazol-5-yl]methoxy]benzamide (PubChem CID 143650945) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 4-[[2-(3,5-dimethoxyphenyl)-4-ethyl-1,3-thiazol-5-yl]methoxy]benzamide.
| Compound Name | 4-[[2-(3,5-dimethoxyphenyl)-4-ethyl-1,3-thiazol-5-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 143650945 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4-[[2-(3,5-dimethoxyphenyl)-4-ethyl-1,3-thiazol-5-yl]methoxy]benzamide |
| SMILES | CCc1nc(-c2cc(OC)cc(OC)c2)sc1COc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C21H22N2O4S/c1-4-18-19(12-27-15-7-5-13(6-8-15)20(22)24)28-21(23-18)14-9-16(25-2)11-17(10-14)26-3/h5-11H,4,12H2,1-3H3,(H2,22,24) |
| InChIKey | BNCIIXPWRBYYAQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |