C47H90N10O2 — CID 14365131
4-N,6-N-bis(3-methoxypropyl)-2-N,2-N,4-N,6-N-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 14365131) has the molecular formula C47H90N10O2 and a molecular weight of 827.30 g/mol. Its IUPAC name is 4-N,6-N-bis(3-methoxypropyl)-2-N,2-N,4-N,6-N-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis(3-methoxypropyl)-2-N,2-N,4-N,6-N-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 14365131 |
| Molecular Formula | C47H90N10O2 |
| Molecular Weight | 827.30 g/mol |
| Exact Mass | 826.72 |
| IUPAC Name | 4-N,6-N-bis(3-methoxypropyl)-2-N,2-N,4-N,6-N-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COCCCN(c1nc(N(CCCOC)C2CC(C)(C)NC(C)(C)C2)nc(N(C2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C47H90N10O2/c1-40(2)25-33(26-41(3,4)51-40)55(21-19-23-58-17)37-48-38(56(22-20-24-59-18)34-27-42(5,6)52-43(7,8)28-34)50-39(49-37)57(35-29-44(9,10)53-45(11,12)30-35)36-31-46(13,14)54-47(15,16)32-36/h33-36,51-54H,19-32H2,1-18H3 |
| InChIKey | HMQNOBNWWHTKCX-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 114.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.30 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|