About ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide
ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide (PubChem CID 143653041) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide.
Molecular Properties
| Compound Name | ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide |
| PubChem CID | 143653041 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide |
| SMILES | C=C(C)N/C=N/CCN1CCCC1.CC |
| InChI | InChI=1S/C10H19N3.C2H6/c1-10(2)12-9-11-5-8-13-6-3-4-7-13;1-2/h9H,1,3-8H2,2H3,(H,11,12);1-2H3 |
| InChIKey | LJRPIELHKUYKDB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide?
The IUPAC name of ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide (CID 143653041) is ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide.
What is the SMILES notation for ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide?
The canonical SMILES for ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide is C=C(C)N/C=N/CCN1CCCC1.CC.
What is the InChIKey of ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide?
The InChIKey is LJRPIELHKUYKDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3.C2H6/c1-10(2)12-9-11-5-8-13-6-3-4-7-13;1-2/h9H,1,3-8H2,2H3,(H,11,12);1-2H3.
What are the key properties of ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide?
ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide has a molecular weight of 211.35 g/mol, XLogP of 2.26, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-prop-1-en-2-yl-N'-(2-pyrrolidin-1-ylethyl)methanimidamide is sourced from PubChem (CID 143653041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).