C17H19N2O2S+ — CID 143653115
CID 143653115 (PubChem CID 143653115) has the molecular formula C17H19N2O2S+ and a molecular weight of 315.42 g/mol.
| Compound Name | CID 143653115 |
|---|---|
| PubChem CID | 143653115 |
| Molecular Formula | C17H19N2O2S+ |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | — |
| SMILES | CC(/C=N/N[S+](=O)(O)c1ccc(C)cc1)=C\c1ccccc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-14-8-10-17(11-9-14)22(20,21)19-18-13-15(2)12-16-6-4-3-5-7-16/h3-13H,1-2H3,(H-,19,20,21)/p+1/b15-12+,18-13+ |
| InChIKey | DHAQTJSJHMULMV-PYEASBQRSA-O |
| XLogP | 3.92 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|