C24H28FN — CID 143653955
5-(3-fluorophenyl)-2-[(E)-2-(3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)ethenyl]pyridine (PubChem CID 143653955) has the molecular formula C24H28FN and a molecular weight of 349.49 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-2-[(E)-2-(3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)ethenyl]pyridine.
| Compound Name | 5-(3-fluorophenyl)-2-[(E)-2-(3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)ethenyl]pyridine |
|---|---|
| PubChem CID | 143653955 |
| Molecular Formula | C24H28FN |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 5-(3-fluorophenyl)-2-[(E)-2-(3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)ethenyl]pyridine |
| SMILES | CC1CC(/C=C/c2ccc(-c3cccc(F)c3)cn2)C2CCCCC2C1 |
| InChI | InChI=1S/C24H28FN/c1-17-13-19-5-2-3-8-24(19)20(14-17)9-11-23-12-10-21(16-26-23)18-6-4-7-22(25)15-18/h4,6-7,9-12,15-17,19-20,24H,2-3,5,8,13-14H2,1H3/b11-9+ |
| InChIKey | KJLLSWRVZIHZJN-PKNBQFBNSA-N |
| XLogP | 6.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |