C27H23F2N7O2 — CID 143654608
acetylene;4-[9-[(2-ethoxy-3-fluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-8-oxo-7H-purin-6-yl]butanenitrile (PubChem CID 143654608) has the molecular formula C27H23F2N7O2 and a molecular weight of 515.52 g/mol. Its IUPAC name is acetylene;4-[9-[(2-ethoxy-3-fluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-8-oxo-7H-purin-6-yl]butanenitrile.
| Compound Name | acetylene;4-[9-[(2-ethoxy-3-fluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-8-oxo-7H-purin-6-yl]butanenitrile |
|---|---|
| PubChem CID | 143654608 |
| Molecular Formula | C27H23F2N7O2 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | acetylene;4-[9-[(2-ethoxy-3-fluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-8-oxo-7H-purin-6-yl]butanenitrile |
| SMILES | C#C.CCOc1c(F)cccc1Cn1c(=O)[nH]c2c(CCCC#N)nc(-n3cnc4ccc(F)cc43)nc21 |
| InChI | InChI=1S/C25H21F2N7O2.C2H2/c1-2-36-22-15(6-5-7-17(22)27)13-33-23-21(31-25(33)35)19(8-3-4-11-28)30-24(32-23)34-14-29-18-10-9-16(26)12-20(18)34;1-2/h5-7,9-10,12,14H,2-4,8,13H2,1H3,(H,31,35);1-2H |
| InChIKey | TVQVZVXDAATMRJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|