C43H30Cl2N4 — CID 143654838
2-[(2Z,4E)-4-chlorohepta-2,4-dien-6-yn-3-yl]-4-[2-(2-chlorophenyl)-4,5-diphenylimidazol-4-yl]-4,5-diphenylimidazole (PubChem CID 143654838) has the molecular formula C43H30Cl2N4 and a molecular weight of 673.65 g/mol. Its IUPAC name is 2-[(2Z,4E)-4-chlorohepta-2,4-dien-6-yn-3-yl]-4-[2-(2-chlorophenyl)-4,5-diphenylimidazol-4-yl]-4,5-diphenylimidazole.
| Compound Name | 2-[(2Z,4E)-4-chlorohepta-2,4-dien-6-yn-3-yl]-4-[2-(2-chlorophenyl)-4,5-diphenylimidazol-4-yl]-4,5-diphenylimidazole |
|---|---|
| PubChem CID | 143654838 |
| Molecular Formula | C43H30Cl2N4 |
| Molecular Weight | 673.65 g/mol |
| Exact Mass | 672.18 |
| IUPAC Name | 2-[(2Z,4E)-4-chlorohepta-2,4-dien-6-yn-3-yl]-4-[2-(2-chlorophenyl)-4,5-diphenylimidazol-4-yl]-4,5-diphenylimidazole |
| SMILES | C#C/C=C(Cl)\C(=C/C)C1=NC(c2ccccc2)(C2(c3ccccc3)N=C(c3ccccc3Cl)N=C2c2ccccc2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C43H30Cl2N4/c1-3-19-36(44)34(4-2)40-46-38(30-20-9-5-10-21-30)42(48-40,32-24-13-7-14-25-32)43(33-26-15-8-16-27-33)39(31-22-11-6-12-23-31)47-41(49-43)35-28-17-18-29-37(35)45/h1,4-29H,2H3/b34-4+,36-19+ |
| InChIKey | RFBVJXKZPASSEQ-RYTYWNKVSA-N |
| XLogP | 9.98 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.65 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|