C18H32N2O — CID 143655663
1-methyl-4-[4-[(6Z)-6-methylocta-1,4,6-trien-2-yl]oxybutyl]piperazine (PubChem CID 143655663) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-methyl-4-[4-[(6Z)-6-methylocta-1,4,6-trien-2-yl]oxybutyl]piperazine.
| Compound Name | 1-methyl-4-[4-[(6Z)-6-methylocta-1,4,6-trien-2-yl]oxybutyl]piperazine |
|---|---|
| PubChem CID | 143655663 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | 1-methyl-4-[4-[(6Z)-6-methylocta-1,4,6-trien-2-yl]oxybutyl]piperazine |
| SMILES | C=C(CC=C/C(C)=C\C)OCCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C18H32N2O/c1-5-17(2)9-8-10-18(3)21-16-7-6-11-20-14-12-19(4)13-15-20/h5,8-9H,3,6-7,10-16H2,1-2,4H3/b9-8?,17-5- |
| InChIKey | USBFEKUGZAWXHF-PZCIGXJRSA-N |
| XLogP | 3.46 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|