C17H28N2O — CID 171071117
1-methyl-4-[4-(4-methylcyclohepta-1,3,6-trien-1-yl)oxybutyl]piperazine (PubChem CID 171071117) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-methyl-4-[4-(4-methylcyclohepta-1,3,6-trien-1-yl)oxybutyl]piperazine.
| Compound Name | 1-methyl-4-[4-(4-methylcyclohepta-1,3,6-trien-1-yl)oxybutyl]piperazine |
|---|---|
| PubChem CID | 171071117 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 1-methyl-4-[4-(4-methylcyclohepta-1,3,6-trien-1-yl)oxybutyl]piperazine |
| SMILES | CC1=CC=C(OCCCCN2CCN(C)CC2)C=CC1 |
| InChI | InChI=1S/C17H28N2O/c1-16-6-5-7-17(9-8-16)20-15-4-3-10-19-13-11-18(2)12-14-19/h5,7-9H,3-4,6,10-15H2,1-2H3 |
| InChIKey | ZQTHMXXGUZNAAE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|