C20H29NO2 — CID 153404535
4-[4-[(1E,2E)-1-cyclohexa-2,4-dien-1-ylidene-3-methylpenta-2,4-dien-2-yl]oxybutyl]morpholine (PubChem CID 153404535) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 4-[4-[(1E,2E)-1-cyclohexa-2,4-dien-1-ylidene-3-methylpenta-2,4-dien-2-yl]oxybutyl]morpholine.
| Compound Name | 4-[4-[(1E,2E)-1-cyclohexa-2,4-dien-1-ylidene-3-methylpenta-2,4-dien-2-yl]oxybutyl]morpholine |
|---|---|
| PubChem CID | 153404535 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 4-[4-[(1E,2E)-1-cyclohexa-2,4-dien-1-ylidene-3-methylpenta-2,4-dien-2-yl]oxybutyl]morpholine |
| SMILES | C=C/C(C)=C(\C=C1\C=CC=CC1)OCCCCN1CCOCC1 |
| InChI | InChI=1S/C20H29NO2/c1-3-18(2)20(17-19-9-5-4-6-10-19)23-14-8-7-11-21-12-15-22-16-13-21/h3-6,9,17H,1,7-8,10-16H2,2H3/b19-17-,20-18+ |
| InChIKey | ROMRUYUDHCDARS-YAFCTCPESA-N |
| XLogP | 4.02 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|