C18H32N2O — CID 142152733
1-[(2E,4Z,6E)-6-ethoxy-5-propylocta-2,4,6-trienyl]-4-methylpiperazine (PubChem CID 142152733) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-[(2E,4Z,6E)-6-ethoxy-5-propylocta-2,4,6-trienyl]-4-methylpiperazine.
| Compound Name | 1-[(2E,4Z,6E)-6-ethoxy-5-propylocta-2,4,6-trienyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 142152733 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | 1-[(2E,4Z,6E)-6-ethoxy-5-propylocta-2,4,6-trienyl]-4-methylpiperazine |
| SMILES | C/C=C(OCC)\C(=C/C=C/CN1CCN(C)CC1)CCC |
| InChI | InChI=1S/C18H32N2O/c1-5-10-17(18(6-2)21-7-3)11-8-9-12-20-15-13-19(4)14-16-20/h6,8-9,11H,5,7,10,12-16H2,1-4H3/b9-8+,17-11-,18-6+ |
| InChIKey | FNHCHGBZLIAXKG-NOKOEBQGSA-N |
| XLogP | 3.46 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|