About 5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium
5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium (PubChem CID 163816935) has the molecular formula C17H33N2O+
and a molecular weight of 281.46 g/mol. Its IUPAC name is 5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium.
Molecular Properties
| Compound Name | 5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium |
| PubChem CID | 163816935 |
| Molecular Formula | C17H33N2O+ |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.26 |
| IUPAC Name | 5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium |
| SMILES | CN(C)CC[N+](C)(C)CCCCCOC1=CCCC=C1 |
| InChI | InChI=1S/C17H33N2O/c1-18(2)13-15-19(3,4)14-9-6-10-16-20-17-11-7-5-8-12-17/h7,11-12H,5-6,8-10,13-16H2,1-4H3/q+1 |
| InChIKey | DCQBMKWESKUPHG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium?
The IUPAC name of 5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium (CID 163816935) is 5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium.
What is the SMILES notation for 5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium?
The canonical SMILES for 5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium is CN(C)CC[N+](C)(C)CCCCCOC1=CCCC=C1.
What is the InChIKey of 5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium?
The InChIKey is DCQBMKWESKUPHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33N2O/c1-18(2)13-15-19(3,4)14-9-6-10-16-20-17-11-7-5-8-12-17/h7,11-12H,5-6,8-10,13-16H2,1-4H3/q+1.
What are the key properties of 5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium?
5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium has a molecular weight of 281.46 g/mol, XLogP of 3.05, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexa-1,5-dien-1-yloxypentyl-[2-(dimethylamino)ethyl]-dimethylazanium is sourced from PubChem (CID 163816935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).