C20H16ClN3O3S — CID 143657254
1'-[(5-chlorofuran-2-yl)methyl]-5-methoxyspiro[2H-furo[3,2-b]pyridine-3,4'-3H-quinazoline]-2'-thione (PubChem CID 143657254) has the molecular formula C20H16ClN3O3S and a molecular weight of 413.89 g/mol. Its IUPAC name is 1'-[(5-chlorofuran-2-yl)methyl]-5-methoxyspiro[2H-furo[3,2-b]pyridine-3,4'-3H-quinazoline]-2'-thione.
| Compound Name | 1'-[(5-chlorofuran-2-yl)methyl]-5-methoxyspiro[2H-furo[3,2-b]pyridine-3,4'-3H-quinazoline]-2'-thione |
|---|---|
| PubChem CID | 143657254 |
| Molecular Formula | C20H16ClN3O3S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 1'-[(5-chlorofuran-2-yl)methyl]-5-methoxyspiro[2H-furo[3,2-b]pyridine-3,4'-3H-quinazoline]-2'-thione |
| SMILES | COc1ccc2c(n1)C1(CO2)NC(=S)N(Cc2ccc(Cl)o2)c2ccccc21 |
| InChI | InChI=1S/C20H16ClN3O3S/c1-25-17-9-7-15-18(22-17)20(11-26-15)13-4-2-3-5-14(13)24(19(28)23-20)10-12-6-8-16(21)27-12/h2-9H,10-11H2,1H3,(H,23,28) |
| InChIKey | WRNWHZAZGITFJD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|