C13H25NO — CID 143657914
ethane;4-[(3E)-hexa-1,3-dien-3-yl]piperidin-4-ol (PubChem CID 143657914) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;4-[(3E)-hexa-1,3-dien-3-yl]piperidin-4-ol.
| Compound Name | ethane;4-[(3E)-hexa-1,3-dien-3-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 143657914 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | ethane;4-[(3E)-hexa-1,3-dien-3-yl]piperidin-4-ol |
| SMILES | C=C/C(=C\CC)C1(O)CCNCC1.CC |
| InChI | InChI=1S/C11H19NO.C2H6/c1-3-5-10(4-2)11(13)6-8-12-9-7-11;1-2/h4-5,12-13H,2-3,6-9H2,1H3;1-2H3/b10-5+; |
| InChIKey | BQKNYGZPVBNNHR-OAZHBLANSA-N |
| XLogP | 2.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|