C21H32N4O — CID 143659404
(E)-3-cyclopropyl-N',4,4-trimethyl-N-[5-(morpholin-4-ylmethyl)-2-pyridinyl]pent-2-enimidamide (PubChem CID 143659404) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is (E)-3-cyclopropyl-N',4,4-trimethyl-N-[5-(morpholin-4-ylmethyl)-2-pyridinyl]pent-2-enimidamide.
| Compound Name | (E)-3-cyclopropyl-N',4,4-trimethyl-N-[5-(morpholin-4-ylmethyl)-2-pyridinyl]pent-2-enimidamide |
|---|---|
| PubChem CID | 143659404 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (E)-3-cyclopropyl-N',4,4-trimethyl-N-[5-(morpholin-4-ylmethyl)-2-pyridinyl]pent-2-enimidamide |
| SMILES | C/N=C(/C=C(\C1CC1)C(C)(C)C)Nc1ccc(CN2CCOCC2)cn1 |
| InChI | InChI=1S/C21H32N4O/c1-21(2,3)18(17-6-7-17)13-20(22-4)24-19-8-5-16(14-23-19)15-25-9-11-26-12-10-25/h5,8,13-14,17H,6-7,9-12,15H2,1-4H3,(H,22,23,24)/b18-13+ |
| InChIKey | PFSWYKCROLASHN-QGOAFFKASA-N |
| XLogP | 3.74 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|