C28H32Cl2N2 — CID 143659517
acetylene;3-chloro-N-[(4Z,6E)-6-[1-(2-chloro-3-methylphenyl)ethylideneamino]-3,5-dimethylocta-1,4,6-trien-2-yl]-4-methylaniline (PubChem CID 143659517) has the molecular formula C28H32Cl2N2 and a molecular weight of 467.48 g/mol. Its IUPAC name is acetylene;3-chloro-N-[(4Z,6E)-6-[1-(2-chloro-3-methylphenyl)ethylideneamino]-3,5-dimethylocta-1,4,6-trien-2-yl]-4-methylaniline.
| Compound Name | acetylene;3-chloro-N-[(4Z,6E)-6-[1-(2-chloro-3-methylphenyl)ethylideneamino]-3,5-dimethylocta-1,4,6-trien-2-yl]-4-methylaniline |
|---|---|
| PubChem CID | 143659517 |
| Molecular Formula | C28H32Cl2N2 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | acetylene;3-chloro-N-[(4Z,6E)-6-[1-(2-chloro-3-methylphenyl)ethylideneamino]-3,5-dimethylocta-1,4,6-trien-2-yl]-4-methylaniline |
| SMILES | C#C.C=C(Nc1ccc(C)c(Cl)c1)C(C)/C=C(C)\C(=C/C)\N=C(/C)c1cccc(C)c1Cl |
| InChI | InChI=1S/C26H30Cl2N2.C2H2/c1-8-25(30-21(7)23-11-9-10-17(3)26(23)28)19(5)14-18(4)20(6)29-22-13-12-16(2)24(27)15-22;1-2/h8-15,18,29H,6H2,1-5,7H3;1-2H/b19-14-,25-8+,30-21+; |
| InChIKey | USWHTOFZOYWBET-BQKHNAFXSA-N |
| XLogP | 8.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|