C30H38N4O3 — CID 143660257
25-methoxy-5-methyl-23-oxa-2,10,28,30-tetrazapentacyclo[22.6.2.110,14.03,8.027,31]tritriaconta-1(30),3(8),4,6,24,26,28,31-octaen-15-one (PubChem CID 143660257) has the molecular formula C30H38N4O3 and a molecular weight of 502.66 g/mol. Its IUPAC name is 25-methoxy-5-methyl-23-oxa-2,10,28,30-tetrazapentacyclo[22.6.2.110,14.03,8.027,31]tritriaconta-1(30),3(8),4,6,24,26,28,31-octaen-15-one.
| Compound Name | 25-methoxy-5-methyl-23-oxa-2,10,28,30-tetrazapentacyclo[22.6.2.110,14.03,8.027,31]tritriaconta-1(30),3(8),4,6,24,26,28,31-octaen-15-one |
|---|---|
| PubChem CID | 143660257 |
| Molecular Formula | C30H38N4O3 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 25-methoxy-5-methyl-23-oxa-2,10,28,30-tetrazapentacyclo[22.6.2.110,14.03,8.027,31]tritriaconta-1(30),3(8),4,6,24,26,28,31-octaen-15-one |
| SMILES | COc1cc2ncnc3c2cc1OCCCCCCCC(=O)C1CCCN(Cc2ccc(C)cc2N3)C1 |
| InChI | InChI=1S/C30H38N4O3/c1-21-11-12-22-18-34-13-8-9-23(19-34)27(35)10-6-4-3-5-7-14-37-29-16-24-26(17-28(29)36-2)31-20-32-30(24)33-25(22)15-21/h11-12,15-17,20,23H,3-10,13-14,18-19H2,1-2H3,(H,31,32,33) |
| InChIKey | ULFZTXCWBFEQQS-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |