C24H27BrN4O3 — CID 90393104
5-bromo-10-methyl-18-[[(2R)-oxiran-2-yl]methoxy]-16-oxa-2,10,21,23-tetrazatetracyclo[15.6.2.03,8.020,24]pentacosa-1(23),3(8),4,6,17,19,21,24-octaene (PubChem CID 90393104) has the molecular formula C24H27BrN4O3 and a molecular weight of 499.41 g/mol. Its IUPAC name is 5-bromo-10-methyl-18-[[(2R)-oxiran-2-yl]methoxy]-16-oxa-2,10,21,23-tetrazatetracyclo[15.6.2.03,8.020,24]pentacosa-1(23),3(8),4,6,17,19,21,24-octaene.
| Compound Name | 5-bromo-10-methyl-18-[[(2R)-oxiran-2-yl]methoxy]-16-oxa-2,10,21,23-tetrazatetracyclo[15.6.2.03,8.020,24]pentacosa-1(23),3(8),4,6,17,19,21,24-octaene |
|---|---|
| PubChem CID | 90393104 |
| Molecular Formula | C24H27BrN4O3 |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 5-bromo-10-methyl-18-[[(2R)-oxiran-2-yl]methoxy]-16-oxa-2,10,21,23-tetrazatetracyclo[15.6.2.03,8.020,24]pentacosa-1(23),3(8),4,6,17,19,21,24-octaene |
| SMILES | CN1CCCCCOc2cc3c(ncnc3cc2OC[C@H]2CO2)Nc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C24H27BrN4O3/c1-29-7-3-2-4-8-30-22-10-19-21(11-23(22)32-14-18-13-31-18)26-15-27-24(19)28-20-9-17(25)6-5-16(20)12-29/h5-6,9-11,15,18H,2-4,7-8,12-14H2,1H3,(H,26,27,28)/t18-/m1/s1 |
| InChIKey | MWUAQKGLHXLJID-GOSISDBHSA-N |
| XLogP | 4.91 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|