C26H31ClFN5O3 — CID 143239629
19-butoxy-5-chloro-6-fluoro-10,11-dimethyl-17-oxa-2,10,13,22,24-pentazatetracyclo[16.6.2.03,8.021,25]hexacosa-1(24),3,5,7,18,20,22,25-octaen-12-one (PubChem CID 143239629) has the molecular formula C26H31ClFN5O3 and a molecular weight of 516.02 g/mol. Its IUPAC name is 19-butoxy-5-chloro-6-fluoro-10,11-dimethyl-17-oxa-2,10,13,22,24-pentazatetracyclo[16.6.2.03,8.021,25]hexacosa-1(24),3,5,7,18,20,22,25-octaen-12-one.
| Compound Name | 19-butoxy-5-chloro-6-fluoro-10,11-dimethyl-17-oxa-2,10,13,22,24-pentazatetracyclo[16.6.2.03,8.021,25]hexacosa-1(24),3,5,7,18,20,22,25-octaen-12-one |
|---|---|
| PubChem CID | 143239629 |
| Molecular Formula | C26H31ClFN5O3 |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 19-butoxy-5-chloro-6-fluoro-10,11-dimethyl-17-oxa-2,10,13,22,24-pentazatetracyclo[16.6.2.03,8.021,25]hexacosa-1(24),3,5,7,18,20,22,25-octaen-12-one |
| SMILES | CCCCOc1cc2ncnc3c2cc1OCCCNC(=O)C(C)N(C)Cc1cc(F)c(Cl)cc1N3 |
| InChI | InChI=1S/C26H31ClFN5O3/c1-4-5-8-35-24-13-22-18-11-23(24)36-9-6-7-29-26(34)16(2)33(3)14-17-10-20(28)19(27)12-21(17)32-25(18)31-15-30-22/h10-13,15-16H,4-9,14H2,1-3H3,(H,29,34)(H,30,31,32) |
| InChIKey | BDSXNIDEQRLYOR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|