C29H39FN6O4 — CID 143239597
6-fluoro-19-[3-[2-hydroxyethyl(methyl)amino]propoxy]-5,10,11-trimethyl-17-oxa-2,10,13,22,24-pentazatetracyclo[16.6.2.03,8.021,25]hexacosa-1(24),3(8),4,6,18,20,22,25-octaen-12-one (PubChem CID 143239597) has the molecular formula C29H39FN6O4 and a molecular weight of 554.67 g/mol. Its IUPAC name is 6-fluoro-19-[3-[2-hydroxyethyl(methyl)amino]propoxy]-5,10,11-trimethyl-17-oxa-2,10,13,22,24-pentazatetracyclo[16.6.2.03,8.021,25]hexacosa-1(24),3(8),4,6,18,20,22,25-octaen-12-one.
| Compound Name | 6-fluoro-19-[3-[2-hydroxyethyl(methyl)amino]propoxy]-5,10,11-trimethyl-17-oxa-2,10,13,22,24-pentazatetracyclo[16.6.2.03,8.021,25]hexacosa-1(24),3(8),4,6,18,20,22,25-octaen-12-one |
|---|---|
| PubChem CID | 143239597 |
| Molecular Formula | C29H39FN6O4 |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | 6-fluoro-19-[3-[2-hydroxyethyl(methyl)amino]propoxy]-5,10,11-trimethyl-17-oxa-2,10,13,22,24-pentazatetracyclo[16.6.2.03,8.021,25]hexacosa-1(24),3(8),4,6,18,20,22,25-octaen-12-one |
| SMILES | Cc1cc2c(cc1F)CN(C)C(C)C(=O)NCCCOc1cc3c(ncnc3cc1OCCCN(C)CCO)N2 |
| InChI | InChI=1S/C29H39FN6O4/c1-19-13-24-21(14-23(19)30)17-36(4)20(2)29(38)31-7-5-11-39-26-15-22-25(32-18-33-28(22)34-24)16-27(26)40-12-6-8-35(3)9-10-37/h13-16,18,20,37H,5-12,17H2,1-4H3,(H,31,38)(H,32,33,34) |
| InChIKey | VKDKQAOIKGCDBX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|