C29H37N5O6S — CID 59176037
4-[3-[(13-methyl-5,7,19-trioxa-2,13,24,26-tetrazapentacyclo[18.6.2.03,11.04,8.023,27]octacosa-1(26),3(11),4(8),9,20,22,24,27-octaen-21-yl)oxy]propyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 59176037) has the molecular formula C29H37N5O6S and a molecular weight of 583.71 g/mol. Its IUPAC name is 4-[3-[(13-methyl-5,7,19-trioxa-2,13,24,26-tetrazapentacyclo[18.6.2.03,11.04,8.023,27]octacosa-1(26),3(11),4(8),9,20,22,24,27-octaen-21-yl)oxy]propyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[3-[(13-methyl-5,7,19-trioxa-2,13,24,26-tetrazapentacyclo[18.6.2.03,11.04,8.023,27]octacosa-1(26),3(11),4(8),9,20,22,24,27-octaen-21-yl)oxy]propyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 59176037 |
| Molecular Formula | C29H37N5O6S |
| Molecular Weight | 583.71 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | 4-[3-[(13-methyl-5,7,19-trioxa-2,13,24,26-tetrazapentacyclo[18.6.2.03,11.04,8.023,27]octacosa-1(26),3(11),4(8),9,20,22,24,27-octaen-21-yl)oxy]propyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | CN1CCCCCOc2cc3c(ncnc3cc2OCCCN2CCS(=O)(=O)CC2)Nc2c(ccc3c2OCO3)C1 |
| InChI | InChI=1S/C29H37N5O6S/c1-33-8-3-2-4-12-37-25-16-22-23(17-26(25)38-13-5-9-34-10-14-41(35,36)15-11-34)30-19-31-29(22)32-27-21(18-33)6-7-24-28(27)40-20-39-24/h6-7,16-17,19H,2-5,8-15,18,20H2,1H3,(H,30,31,32) |
| InChIKey | CKYOQZLZWYPFMO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|