C18H22N4S3 — CID 143660890
2-[5-(aminomethyl)-4,5-dihydro-1,3-thiazol-2-yl]-N,5-dimethyl-1H-indol-7-amine;thiophene-2-thiol (PubChem CID 143660890) has the molecular formula C18H22N4S3 and a molecular weight of 390.60 g/mol. Its IUPAC name is 2-[5-(aminomethyl)-4,5-dihydro-1,3-thiazol-2-yl]-N,5-dimethyl-1H-indol-7-amine;thiophene-2-thiol.
| Compound Name | 2-[5-(aminomethyl)-4,5-dihydro-1,3-thiazol-2-yl]-N,5-dimethyl-1H-indol-7-amine;thiophene-2-thiol |
|---|---|
| PubChem CID | 143660890 |
| Molecular Formula | C18H22N4S3 |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-[5-(aminomethyl)-4,5-dihydro-1,3-thiazol-2-yl]-N,5-dimethyl-1H-indol-7-amine;thiophene-2-thiol |
| SMILES | CNc1cc(C)cc2cc(C3=NCC(CN)S3)[nH]c12.Sc1cccs1 |
| InChI | InChI=1S/C14H18N4S.C4H4S2/c1-8-3-9-5-12(14-17-7-10(6-15)19-14)18-13(9)11(4-8)16-2;5-4-2-1-3-6-4/h3-5,10,16,18H,6-7,15H2,1-2H3;1-3,5H |
| InChIKey | GWIZRGBAOONCPE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|