C20H22N6O2 — CID 143662424
(Z)-2-amino-N-[3-(1,7-dimethyl-2-oxo-1,6-naphthyridin-3-yl)-4-methylphenyl]-3-hydrazinylprop-2-enamide (PubChem CID 143662424) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is (Z)-2-amino-N-[3-(1,7-dimethyl-2-oxo-1,6-naphthyridin-3-yl)-4-methylphenyl]-3-hydrazinylprop-2-enamide.
| Compound Name | (Z)-2-amino-N-[3-(1,7-dimethyl-2-oxo-1,6-naphthyridin-3-yl)-4-methylphenyl]-3-hydrazinylprop-2-enamide |
|---|---|
| PubChem CID | 143662424 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (Z)-2-amino-N-[3-(1,7-dimethyl-2-oxo-1,6-naphthyridin-3-yl)-4-methylphenyl]-3-hydrazinylprop-2-enamide |
| SMILES | Cc1cc2c(cn1)cc(-c1cc(NC(=O)/C(N)=C/NN)ccc1C)c(=O)n2C |
| InChI | InChI=1S/C20H22N6O2/c1-11-4-5-14(25-19(27)17(21)10-24-22)8-15(11)16-7-13-9-23-12(2)6-18(13)26(3)20(16)28/h4-10,24H,21-22H2,1-3H3,(H,25,27)/b17-10- |
| InChIKey | NPCFDCRBBJLWQC-YVLHZVERSA-N |
| XLogP | 1.42 |
| TPSA | 128.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|