C27H31N3O2 — CID 162287747
N-[3-(1,7-dimethyl-2-oxo-1,6-naphthyridin-3-yl)-4-methylphenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxamide (PubChem CID 162287747) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is N-[3-(1,7-dimethyl-2-oxo-1,6-naphthyridin-3-yl)-4-methylphenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxamide.
| Compound Name | N-[3-(1,7-dimethyl-2-oxo-1,6-naphthyridin-3-yl)-4-methylphenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 162287747 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-[3-(1,7-dimethyl-2-oxo-1,6-naphthyridin-3-yl)-4-methylphenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carboxamide |
| SMILES | Cc1cc2c(cn1)cc(-c1cc(NC(=O)C3CC4CCCCC4C3)ccc1C)c(=O)n2C |
| InChI | InChI=1S/C27H31N3O2/c1-16-8-9-22(29-26(31)20-11-18-6-4-5-7-19(18)12-20)14-23(16)24-13-21-15-28-17(2)10-25(21)30(3)27(24)32/h8-10,13-15,18-20H,4-7,11-12H2,1-3H3,(H,29,31) |
| InChIKey | XPCMQPZVSAAKKZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |