C24H25N3O2 — CID 143852495
3-[5-[[(3Z)-4-cyclopropyl-4-hydroxybuta-1,3-dien-2-yl]amino]-2-methylphenyl]-1,7-dimethyl-1,6-naphthyridin-2-one (PubChem CID 143852495) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-[5-[[(3Z)-4-cyclopropyl-4-hydroxybuta-1,3-dien-2-yl]amino]-2-methylphenyl]-1,7-dimethyl-1,6-naphthyridin-2-one.
| Compound Name | 3-[5-[[(3Z)-4-cyclopropyl-4-hydroxybuta-1,3-dien-2-yl]amino]-2-methylphenyl]-1,7-dimethyl-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 143852495 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3-[5-[[(3Z)-4-cyclopropyl-4-hydroxybuta-1,3-dien-2-yl]amino]-2-methylphenyl]-1,7-dimethyl-1,6-naphthyridin-2-one |
| SMILES | C=C(/C=C(\O)C1CC1)Nc1ccc(C)c(-c2cc3cnc(C)cc3n(C)c2=O)c1 |
| InChI | InChI=1S/C24H25N3O2/c1-14-5-8-19(26-16(3)10-23(28)17-6-7-17)12-20(14)21-11-18-13-25-15(2)9-22(18)27(4)24(21)29/h5,8-13,17,26,28H,3,6-7H2,1-2,4H3/b23-10- |
| InChIKey | JBELIIIGWGAFLZ-RMORIDSASA-N |
| XLogP | 4.99 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|