C35H37N3O2 — CID 143663307
[4-methyl-3-[[2-methyl-1-(3-phenoxyphenyl)butylidene]amino]phenyl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 143663307) has the molecular formula C35H37N3O2 and a molecular weight of 531.70 g/mol. Its IUPAC name is [4-methyl-3-[[2-methyl-1-(3-phenoxyphenyl)butylidene]amino]phenyl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [4-methyl-3-[[2-methyl-1-(3-phenoxyphenyl)butylidene]amino]phenyl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 143663307 |
| Molecular Formula | C35H37N3O2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | [4-methyl-3-[[2-methyl-1-(3-phenoxyphenyl)butylidene]amino]phenyl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | CCC(C)/C(=N\c1cc(C(=O)N2CCN(c3ccccc3)CC2)ccc1C)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C35H37N3O2/c1-4-26(2)34(28-12-11-17-32(24-28)40-31-15-9-6-10-16-31)36-33-25-29(19-18-27(33)3)35(39)38-22-20-37(21-23-38)30-13-7-5-8-14-30/h5-19,24-26H,4,20-23H2,1-3H3/b36-34+ |
| InChIKey | ZRIQUMKQVBACMO-JMUUFCRMSA-N |
| XLogP | 7.92 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|