C16H26O4 — CID 143663790
ethane;methyl 3-(4-methoxy-3,5-dimethylcyclohepta-2,4-dien-1-yl)-3-oxopropanoate (PubChem CID 143663790) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is ethane;methyl 3-(4-methoxy-3,5-dimethylcyclohepta-2,4-dien-1-yl)-3-oxopropanoate.
| Compound Name | ethane;methyl 3-(4-methoxy-3,5-dimethylcyclohepta-2,4-dien-1-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 143663790 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | ethane;methyl 3-(4-methoxy-3,5-dimethylcyclohepta-2,4-dien-1-yl)-3-oxopropanoate |
| SMILES | CC.COC(=O)CC(=O)C1C=C(C)C(OC)=C(C)CC1 |
| InChI | InChI=1S/C14H20O4.C2H6/c1-9-5-6-11(7-10(2)14(9)18-4)12(15)8-13(16)17-3;1-2/h7,11H,5-6,8H2,1-4H3;1-2H3 |
| InChIKey | BTKCLAMXWAPWCR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|